C14H12ClN3O2S — CID 65473266
4-[1-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethyl]benzene-1,3-diol (PubChem CID 65473266) has the molecular formula C14H12ClN3O2S and a molecular weight of 321.79 g/mol. Its IUPAC name is 4-[1-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethyl]benzene-1,3-diol.
| Compound Name | 4-[1-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 65473266 |
| Molecular Formula | C14H12ClN3O2S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 4-[1-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethyl]benzene-1,3-diol |
| SMILES | CC(Nc1c(Cl)ccc2nsnc12)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H12ClN3O2S/c1-7(9-3-2-8(19)6-12(9)20)16-13-10(15)4-5-11-14(13)18-21-17-11/h2-7,16,19-20H,1H3 |
| InChIKey | FOBMELUZKDUDTJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|