C15H15BrClNO2 — CID 104722788
4-[1-(2-bromo-5-chloro-4-methylanilino)ethyl]benzene-1,3-diol (PubChem CID 104722788) has the molecular formula C15H15BrClNO2 and a molecular weight of 356.65 g/mol. Its IUPAC name is 4-[1-(2-bromo-5-chloro-4-methylanilino)ethyl]benzene-1,3-diol.
| Compound Name | 4-[1-(2-bromo-5-chloro-4-methylanilino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 104722788 |
| Molecular Formula | C15H15BrClNO2 |
| Molecular Weight | 356.65 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 4-[1-(2-bromo-5-chloro-4-methylanilino)ethyl]benzene-1,3-diol |
| SMILES | Cc1cc(Br)c(NC(C)c2ccc(O)cc2O)cc1Cl |
| InChI | InChI=1S/C15H15BrClNO2/c1-8-5-12(16)14(7-13(8)17)18-9(2)11-4-3-10(19)6-15(11)20/h3-7,9,18-20H,1-2H3 |
| InChIKey | MJRPIDJLOCUCJL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|