C16H17Cl2NO2 — CID 104726376
2-[1-(2,5-dichloro-4-methylanilino)ethyl]-5-methoxyphenol (PubChem CID 104726376) has the molecular formula C16H17Cl2NO2 and a molecular weight of 326.22 g/mol. Its IUPAC name is 2-[1-(2,5-dichloro-4-methylanilino)ethyl]-5-methoxyphenol.
| Compound Name | 2-[1-(2,5-dichloro-4-methylanilino)ethyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 104726376 |
| Molecular Formula | C16H17Cl2NO2 |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-[1-(2,5-dichloro-4-methylanilino)ethyl]-5-methoxyphenol |
| SMILES | COc1ccc(C(C)Nc2cc(Cl)c(C)cc2Cl)c(O)c1 |
| InChI | InChI=1S/C16H17Cl2NO2/c1-9-6-14(18)15(8-13(9)17)19-10(2)12-5-4-11(21-3)7-16(12)20/h4-8,10,19-20H,1-3H3 |
| InChIKey | PLWMWMMIMYBYOU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|