C14H11ClIN3S — CID 65473673
5-chloro-N-[1-(4-iodophenyl)ethyl]-2,1,3-benzothiadiazol-4-amine (PubChem CID 65473673) has the molecular formula C14H11ClIN3S and a molecular weight of 415.69 g/mol. Its IUPAC name is 5-chloro-N-[1-(4-iodophenyl)ethyl]-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 5-chloro-N-[1-(4-iodophenyl)ethyl]-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 65473673 |
| Molecular Formula | C14H11ClIN3S |
| Molecular Weight | 415.69 g/mol |
| Exact Mass | 414.94 |
| IUPAC Name | 5-chloro-N-[1-(4-iodophenyl)ethyl]-2,1,3-benzothiadiazol-4-amine |
| SMILES | CC(Nc1c(Cl)ccc2nsnc12)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H11ClIN3S/c1-8(9-2-4-10(16)5-3-9)17-13-11(15)6-7-12-14(13)19-20-18-12/h2-8,17H,1H3 |
| InChIKey | SVXIIJLNXHYGRI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.69 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|