C14H15ClN2S — CID 43674852
5-chloro-N-(dicyclopropylmethyl)-1,3-benzothiazol-4-amine (PubChem CID 43674852) has the molecular formula C14H15ClN2S and a molecular weight of 278.81 g/mol. Its IUPAC name is 5-chloro-N-(dicyclopropylmethyl)-1,3-benzothiazol-4-amine.
| Compound Name | 5-chloro-N-(dicyclopropylmethyl)-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 43674852 |
| Molecular Formula | C14H15ClN2S |
| Molecular Weight | 278.81 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 5-chloro-N-(dicyclopropylmethyl)-1,3-benzothiazol-4-amine |
| SMILES | Clc1ccc2scnc2c1NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C14H15ClN2S/c15-10-5-6-11-14(16-7-18-11)13(10)17-12(8-1-2-8)9-3-4-9/h5-9,12,17H,1-4H2 |
| InChIKey | QWFMUBIIEKHULO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.81 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |