C13H16ClN3S — CID 106633191
5-chloro-N-(piperidin-2-ylmethyl)-1,3-benzothiazol-4-amine (PubChem CID 106633191) has the molecular formula C13H16ClN3S and a molecular weight of 281.81 g/mol. Its IUPAC name is 5-chloro-N-(piperidin-2-ylmethyl)-1,3-benzothiazol-4-amine.
| Compound Name | 5-chloro-N-(piperidin-2-ylmethyl)-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 106633191 |
| Molecular Formula | C13H16ClN3S |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 5-chloro-N-(piperidin-2-ylmethyl)-1,3-benzothiazol-4-amine |
| SMILES | Clc1ccc2scnc2c1NCC1CCCCN1 |
| InChI | InChI=1S/C13H16ClN3S/c14-10-4-5-11-13(17-8-18-11)12(10)16-7-9-3-1-2-6-15-9/h4-5,8-9,15-16H,1-3,6-7H2 |
| InChIKey | PHRBUSGUKYEDPC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |