C11H15Br2N — CID 107597667
2,6-dibromo-N-pentan-3-ylaniline (PubChem CID 107597667) has the molecular formula C11H15Br2N and a molecular weight of 321.06 g/mol. Its IUPAC name is 2,6-dibromo-N-pentan-3-ylaniline.
| Compound Name | 2,6-dibromo-N-pentan-3-ylaniline |
|---|---|
| PubChem CID | 107597667 |
| Molecular Formula | C11H15Br2N |
| Molecular Weight | 321.06 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | 2,6-dibromo-N-pentan-3-ylaniline |
| SMILES | CCC(CC)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C11H15Br2N/c1-3-8(4-2)14-11-9(12)6-5-7-10(11)13/h5-8,14H,3-4H2,1-2H3 |
| InChIKey | ASDWQIXCYPEOPR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.06 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |