C11H12Br2N2 — CID 107599042
3-(2,6-dibromoanilino)pentanenitrile (PubChem CID 107599042) has the molecular formula C11H12Br2N2 and a molecular weight of 332.04 g/mol. Its IUPAC name is 3-(2,6-dibromoanilino)pentanenitrile.
| Compound Name | 3-(2,6-dibromoanilino)pentanenitrile |
|---|---|
| PubChem CID | 107599042 |
| Molecular Formula | C11H12Br2N2 |
| Molecular Weight | 332.04 g/mol |
| Exact Mass | 329.94 |
| IUPAC Name | 3-(2,6-dibromoanilino)pentanenitrile |
| SMILES | CCC(CC#N)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C11H12Br2N2/c1-2-8(6-7-14)15-11-9(12)4-3-5-10(11)13/h3-5,8,15H,2,6H2,1H3 |
| InChIKey | RUFPHNAODTWPOE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.04 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |