C13H17BrN2 — CID 81360191
3-[[(1R)-1-(4-bromophenyl)ethyl]amino]pentanenitrile (PubChem CID 81360191) has the molecular formula C13H17BrN2 and a molecular weight of 281.20 g/mol. Its IUPAC name is 3-[[(1R)-1-(4-bromophenyl)ethyl]amino]pentanenitrile.
| Compound Name | 3-[[(1R)-1-(4-bromophenyl)ethyl]amino]pentanenitrile |
|---|---|
| PubChem CID | 81360191 |
| Molecular Formula | C13H17BrN2 |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 3-[[(1R)-1-(4-bromophenyl)ethyl]amino]pentanenitrile |
| SMILES | CCC(CC#N)N[C@H](C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H17BrN2/c1-3-13(8-9-15)16-10(2)11-4-6-12(14)7-5-11/h4-7,10,13,16H,3,8H2,1-2H3/t10-,13?/m1/s1 |
| InChIKey | OAEBAXFGVIVVQU-VUUHIHSGSA-N |
| XLogP | 3.79 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |