C14H18F2N2O — CID 62646051
3-[1-[4-(difluoromethoxy)phenyl]ethylamino]pentanenitrile (PubChem CID 62646051) has the molecular formula C14H18F2N2O and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-[1-[4-(difluoromethoxy)phenyl]ethylamino]pentanenitrile.
| Compound Name | 3-[1-[4-(difluoromethoxy)phenyl]ethylamino]pentanenitrile |
|---|---|
| PubChem CID | 62646051 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-[1-[4-(difluoromethoxy)phenyl]ethylamino]pentanenitrile |
| SMILES | CCC(CC#N)NC(C)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H18F2N2O/c1-3-12(8-9-17)18-10(2)11-4-6-13(7-5-11)19-14(15)16/h4-7,10,12,14,18H,3,8H2,1-2H3 |
| InChIKey | LQLRKLNHPVFWJQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |