C10H9Br3N2 — CID 60913132
3-(2,4,6-tribromoanilino)butanenitrile (PubChem CID 60913132) has the molecular formula C10H9Br3N2 and a molecular weight of 396.91 g/mol. Its IUPAC name is 3-(2,4,6-tribromoanilino)butanenitrile.
| Compound Name | 3-(2,4,6-tribromoanilino)butanenitrile |
|---|---|
| PubChem CID | 60913132 |
| Molecular Formula | C10H9Br3N2 |
| Molecular Weight | 396.91 g/mol |
| Exact Mass | 393.83 |
| IUPAC Name | 3-(2,4,6-tribromoanilino)butanenitrile |
| SMILES | CC(CC#N)Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C10H9Br3N2/c1-6(2-3-14)15-10-8(12)4-7(11)5-9(10)13/h4-6,15H,2H2,1H3 |
| InChIKey | HPVWTUFXSAEVTJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |