C11H14Br3N — CID 43126298
2,4,6-tribromo-N-pentan-2-ylaniline (PubChem CID 43126298) has the molecular formula C11H14Br3N and a molecular weight of 399.95 g/mol. Its IUPAC name is 2,4,6-tribromo-N-pentan-2-ylaniline.
| Compound Name | 2,4,6-tribromo-N-pentan-2-ylaniline |
|---|---|
| PubChem CID | 43126298 |
| Molecular Formula | C11H14Br3N |
| Molecular Weight | 399.95 g/mol |
| Exact Mass | 396.87 |
| IUPAC Name | 2,4,6-tribromo-N-pentan-2-ylaniline |
| SMILES | CCCC(C)Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C11H14Br3N/c1-3-4-7(2)15-11-9(13)5-8(12)6-10(11)14/h5-7,15H,3-4H2,1-2H3 |
| InChIKey | OEEJSXTTWZVALP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.95 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |