C16H15BrN2O2S — CID 1345270
(E)-N-[(4-bromo-2,6-dimethylphenyl)carbamothioyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 1345270) has the molecular formula C16H15BrN2O2S and a molecular weight of 379.28 g/mol. Its IUPAC name is (E)-N-[(4-bromo-2,6-dimethylphenyl)carbamothioyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[(4-bromo-2,6-dimethylphenyl)carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 1345270 |
| Molecular Formula | C16H15BrN2O2S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | (E)-N-[(4-bromo-2,6-dimethylphenyl)carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | Cc1cc(Br)cc(C)c1NC(=S)NC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C16H15BrN2O2S/c1-10-8-12(17)9-11(2)15(10)19-16(22)18-14(20)6-5-13-4-3-7-21-13/h3-9H,1-2H3,(H2,18,19,20,22)/b6-5+ |
| InChIKey | LJGDPADCZNOBOS-AATRIKPKSA-N |
| XLogP | 4.19 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|