C14H9Cl3N2O2S — CID 1040010
(E)-3-(furan-2-yl)-N-[(2,4,6-trichlorophenyl)carbamothioyl]prop-2-enamide (PubChem CID 1040010) has the molecular formula C14H9Cl3N2O2S and a molecular weight of 375.66 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[(2,4,6-trichlorophenyl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[(2,4,6-trichlorophenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 1040010 |
| Molecular Formula | C14H9Cl3N2O2S |
| Molecular Weight | 375.66 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[(2,4,6-trichlorophenyl)carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NC(=S)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl3N2O2S/c15-8-6-10(16)13(11(17)7-8)19-14(22)18-12(20)4-3-9-2-1-5-21-9/h1-7H,(H2,18,19,20,22)/b4-3+ |
| InChIKey | ZAABPWLJOGVIQA-ONEGZZNKSA-N |
| XLogP | 4.77 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.66 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|