C15H11Cl2N3O3S — CID 6134681
(E)-N-[[(2,4-dichlorobenzoyl)amino]carbamothioyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 6134681) has the molecular formula C15H11Cl2N3O3S and a molecular weight of 384.24 g/mol. Its IUPAC name is (E)-N-[[(2,4-dichlorobenzoyl)amino]carbamothioyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[[(2,4-dichlorobenzoyl)amino]carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6134681 |
| Molecular Formula | C15H11Cl2N3O3S |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | (E)-N-[[(2,4-dichlorobenzoyl)amino]carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NC(=S)NNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl2N3O3S/c16-9-3-5-11(12(17)8-9)14(22)19-20-15(24)18-13(21)6-4-10-2-1-7-23-10/h1-8H,(H,19,22)(H2,18,20,21,24)/b6-4+ |
| InChIKey | DRUXPMKULMERGB-GQCTYLIASA-N |
| XLogP | 2.94 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|