C15H21ClN2OS — CID 19189257
N-[(2-chloro-4,6-dimethylphenyl)carbamothioyl]-3,3-dimethylbutanamide (PubChem CID 19189257) has the molecular formula C15H21ClN2OS and a molecular weight of 312.87 g/mol. Its IUPAC name is N-[(2-chloro-4,6-dimethylphenyl)carbamothioyl]-3,3-dimethylbutanamide.
| Compound Name | N-[(2-chloro-4,6-dimethylphenyl)carbamothioyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 19189257 |
| Molecular Formula | C15H21ClN2OS |
| Molecular Weight | 312.87 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-[(2-chloro-4,6-dimethylphenyl)carbamothioyl]-3,3-dimethylbutanamide |
| SMILES | Cc1cc(C)c(NC(=S)NC(=O)CC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C15H21ClN2OS/c1-9-6-10(2)13(11(16)7-9)18-14(20)17-12(19)8-15(3,4)5/h6-7H,8H2,1-5H3,(H2,17,18,19,20) |
| InChIKey | GJVKALGJEYPFLM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.87 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|