C15H13Cl3N2S — CID 5012399
1-(2-chloro-4,6-dimethylphenyl)-3-(3,5-dichlorophenyl)thiourea (PubChem CID 5012399) has the molecular formula C15H13Cl3N2S and a molecular weight of 359.71 g/mol. Its IUPAC name is 1-(2-chloro-4,6-dimethylphenyl)-3-(3,5-dichlorophenyl)thiourea.
| Compound Name | 1-(2-chloro-4,6-dimethylphenyl)-3-(3,5-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 5012399 |
| Molecular Formula | C15H13Cl3N2S |
| Molecular Weight | 359.71 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | 1-(2-chloro-4,6-dimethylphenyl)-3-(3,5-dichlorophenyl)thiourea |
| SMILES | Cc1cc(C)c(NC(=S)Nc2cc(Cl)cc(Cl)c2)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl3N2S/c1-8-3-9(2)14(13(18)4-8)20-15(21)19-12-6-10(16)5-11(17)7-12/h3-7H,1-2H3,(H2,19,20,21) |
| InChIKey | CQVJQPGASBIHLU-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.71 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|