C15H13Cl3N2O2S — CID 17300163
1-(4-chloro-2,5-dimethoxyphenyl)-3-(3,5-dichlorophenyl)thiourea (PubChem CID 17300163) has the molecular formula C15H13Cl3N2O2S and a molecular weight of 391.71 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-3-(3,5-dichlorophenyl)thiourea.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-(3,5-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 17300163 |
| Molecular Formula | C15H13Cl3N2O2S |
| Molecular Weight | 391.71 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-(3,5-dichlorophenyl)thiourea |
| SMILES | COc1cc(NC(=S)Nc2cc(Cl)cc(Cl)c2)c(OC)cc1Cl |
| InChI | InChI=1S/C15H13Cl3N2O2S/c1-21-13-7-12(14(22-2)6-11(13)18)20-15(23)19-10-4-8(16)3-9(17)5-10/h3-7H,1-2H3,(H2,19,20,23) |
| InChIKey | DJBDNZVFJQLGGF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.71 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|