C16H14Cl3N3O3S — CID 137304019
1-(4-chloro-2,5-dimethoxyphenyl)-3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]thiourea (PubChem CID 137304019) has the molecular formula C16H14Cl3N3O3S and a molecular weight of 434.73 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 137304019 |
| Molecular Formula | C16H14Cl3N3O3S |
| Molecular Weight | 434.73 g/mol |
| Exact Mass | 432.98 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]thiourea |
| SMILES | COc1cc(NC(=S)N/N=C/c2cc(Cl)cc(Cl)c2O)c(OC)cc1Cl |
| InChI | InChI=1S/C16H14Cl3N3O3S/c1-24-13-6-12(14(25-2)5-10(13)18)21-16(26)22-20-7-8-3-9(17)4-11(19)15(8)23/h3-7,23H,1-2H3,(H2,21,22,26)/b20-7+ |
| InChIKey | YUYXIUKDHGPAKW-IFRROFPPSA-N |
| XLogP | 4.69 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.73 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|