C22H15Cl4N5O3S — CID 135520646
N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-[[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamothioylamino]benzamide (PubChem CID 135520646) has the molecular formula C22H15Cl4N5O3S and a molecular weight of 571.27 g/mol. Its IUPAC name is N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-[[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamothioylamino]benzamide.
| Compound Name | N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-[[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 135520646 |
| Molecular Formula | C22H15Cl4N5O3S |
| Molecular Weight | 571.27 g/mol |
| Exact Mass | 568.96 |
| IUPAC Name | N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-[[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamothioylamino]benzamide |
| SMILES | O=C(N/N=C/c1cc(Cl)cc(Cl)c1O)c1ccccc1NC(=S)N/N=C/c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C22H15Cl4N5O3S/c23-13-5-11(19(32)16(25)7-13)9-27-30-21(34)15-3-1-2-4-18(15)29-22(35)31-28-10-12-6-14(24)8-17(26)20(12)33/h1-10,32-33H,(H,30,34)(H2,29,31,35)/b27-9+,28-10+ |
| InChIKey | QBQNVEAXFMMJMX-YEBYOEETSA-N |
| XLogP | 5.80 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.27 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|