C19H23ClN2O4 — CID 109008811
N-(2-chloro-4,6-dimethylphenyl)-2-(3,4,5-trimethoxyanilino)acetamide (PubChem CID 109008811) has the molecular formula C19H23ClN2O4 and a molecular weight of 378.86 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-2-(3,4,5-trimethoxyanilino)acetamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-2-(3,4,5-trimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 109008811 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-2-(3,4,5-trimethoxyanilino)acetamide |
| SMILES | COc1cc(NCC(=O)Nc2c(C)cc(C)cc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C19H23ClN2O4/c1-11-6-12(2)18(14(20)7-11)22-17(23)10-21-13-8-15(24-3)19(26-5)16(9-13)25-4/h6-9,21H,10H2,1-5H3,(H,22,23) |
| InChIKey | XJTHBDCETJMTML-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|