C22H29N3O5 — CID 55362409
N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-2-(3,4,5-trimethoxyanilino)acetamide (PubChem CID 55362409) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-2-(3,4,5-trimethoxyanilino)acetamide.
| Compound Name | N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-2-(3,4,5-trimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 55362409 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-2-(3,4,5-trimethoxyanilino)acetamide |
| SMILES | COc1cc(NCC(=O)NCC(=O)Nc2c(C)cc(C)cc2C)cc(OC)c1OC |
| InChI | InChI=1S/C22H29N3O5/c1-13-7-14(2)21(15(3)8-13)25-20(27)12-24-19(26)11-23-16-9-17(28-4)22(30-6)18(10-16)29-5/h7-10,23H,11-12H2,1-6H3,(H,24,26)(H,25,27) |
| InChIKey | RSSZRUCGKXCLAT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|