C17H16N4O5S — CID 4629752
3,5-dinitro-N-[(2,4,6-trimethylphenyl)carbamothioyl]benzamide (PubChem CID 4629752) has the molecular formula C17H16N4O5S and a molecular weight of 388.41 g/mol. Its IUPAC name is 3,5-dinitro-N-[(2,4,6-trimethylphenyl)carbamothioyl]benzamide.
| Compound Name | 3,5-dinitro-N-[(2,4,6-trimethylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4629752 |
| Molecular Formula | C17H16N4O5S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 3,5-dinitro-N-[(2,4,6-trimethylphenyl)carbamothioyl]benzamide |
| SMILES | Cc1cc(C)c(NC(=S)NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C17H16N4O5S/c1-9-4-10(2)15(11(3)5-9)18-17(27)19-16(22)12-6-13(20(23)24)8-14(7-12)21(25)26/h4-8H,1-3H3,(H2,18,19,22,27) |
| InChIKey | FEDDGMOQVODCBB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|