C16H16N6O5S — CID 139214285
N-[(4,6-diethylpyrimidin-2-yl)carbamothioyl]-3,5-dinitrobenzamide (PubChem CID 139214285) has the molecular formula C16H16N6O5S and a molecular weight of 404.41 g/mol. Its IUPAC name is N-[(4,6-diethylpyrimidin-2-yl)carbamothioyl]-3,5-dinitrobenzamide.
| Compound Name | N-[(4,6-diethylpyrimidin-2-yl)carbamothioyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 139214285 |
| Molecular Formula | C16H16N6O5S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | N-[(4,6-diethylpyrimidin-2-yl)carbamothioyl]-3,5-dinitrobenzamide |
| SMILES | CCc1cc(CC)nc(NC(=S)NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C16H16N6O5S/c1-3-10-7-11(4-2)18-15(17-10)20-16(28)19-14(23)9-5-12(21(24)25)8-13(6-9)22(26)27/h5-8H,3-4H2,1-2H3,(H2,17,18,19,20,23,28) |
| InChIKey | VLKBMOVBLWVKOE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|