C8H5N3O5S2 — CID 51059464
(3,5-dinitrobenzoyl)carbamodithioic acid (PubChem CID 51059464) has the molecular formula C8H5N3O5S2 and a molecular weight of 287.28 g/mol. Its IUPAC name is (3,5-dinitrobenzoyl)carbamodithioic acid.
| Compound Name | (3,5-dinitrobenzoyl)carbamodithioic acid |
|---|---|
| PubChem CID | 51059464 |
| Molecular Formula | C8H5N3O5S2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | (3,5-dinitrobenzoyl)carbamodithioic acid |
| SMILES | O=C(NC(=S)S)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H5N3O5S2/c12-7(9-8(17)18)4-1-5(10(13)14)3-6(2-4)11(15)16/h1-3H,(H2,9,12,17,18) |
| InChIKey | GBHWZOZBAZGIHB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|