C8H7N3O7S — CID 90139670
N-methylsulfonyl-3,5-dinitrobenzamide (PubChem CID 90139670) has the molecular formula C8H7N3O7S and a molecular weight of 289.23 g/mol. Its IUPAC name is N-methylsulfonyl-3,5-dinitrobenzamide.
| Compound Name | N-methylsulfonyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 90139670 |
| Molecular Formula | C8H7N3O7S |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | N-methylsulfonyl-3,5-dinitrobenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H7N3O7S/c1-19(17,18)9-8(12)5-2-6(10(13)14)4-7(3-5)11(15)16/h2-4H,1H3,(H,9,12) |
| InChIKey | XZTZWEYKIGRKJY-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|