C18H19N5O5S — CID 4629597
N-[[4-(diethylamino)phenyl]carbamothioyl]-3,5-dinitrobenzamide (PubChem CID 4629597) has the molecular formula C18H19N5O5S and a molecular weight of 417.45 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]carbamothioyl]-3,5-dinitrobenzamide.
| Compound Name | N-[[4-(diethylamino)phenyl]carbamothioyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4629597 |
| Molecular Formula | C18H19N5O5S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]carbamothioyl]-3,5-dinitrobenzamide |
| SMILES | CCN(CC)c1ccc(NC(=S)NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H19N5O5S/c1-3-21(4-2)14-7-5-13(6-8-14)19-18(29)20-17(24)12-9-15(22(25)26)11-16(10-12)23(27)28/h5-11H,3-4H2,1-2H3,(H2,19,20,24,29) |
| InChIKey | PVFCMSOCCYLTGA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|