C23H19N5O6S — CID 17222089
N-[[3-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]-3,5-dinitrobenzamide (PubChem CID 17222089) has the molecular formula C23H19N5O6S and a molecular weight of 493.50 g/mol. Its IUPAC name is N-[[3-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]-3,5-dinitrobenzamide.
| Compound Name | N-[[3-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 17222089 |
| Molecular Formula | C23H19N5O6S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | N-[[3-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]-3,5-dinitrobenzamide |
| SMILES | CCN(C(=O)c1cccc(NC(=S)NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H19N5O6S/c1-2-26(18-9-4-3-5-10-18)22(30)15-7-6-8-17(11-15)24-23(35)25-21(29)16-12-19(27(31)32)14-20(13-16)28(33)34/h3-14H,2H2,1H3,(H2,24,25,29,35) |
| InChIKey | QNKBMCCCLGEHCM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|