C18H18N4O6S — CID 17074345
N-[[2-(2-methylpropoxy)phenyl]carbamothioyl]-3,5-dinitrobenzamide (PubChem CID 17074345) has the molecular formula C18H18N4O6S and a molecular weight of 418.43 g/mol. Its IUPAC name is N-[[2-(2-methylpropoxy)phenyl]carbamothioyl]-3,5-dinitrobenzamide.
| Compound Name | N-[[2-(2-methylpropoxy)phenyl]carbamothioyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 17074345 |
| Molecular Formula | C18H18N4O6S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-[[2-(2-methylpropoxy)phenyl]carbamothioyl]-3,5-dinitrobenzamide |
| SMILES | CC(C)COc1ccccc1NC(=S)NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18N4O6S/c1-11(2)10-28-16-6-4-3-5-15(16)19-18(29)20-17(23)12-7-13(21(24)25)9-14(8-12)22(26)27/h3-9,11H,10H2,1-2H3,(H2,19,20,23,29) |
| InChIKey | XTPQLKSUJZQAHN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|