C16H18N2O2S2 — CID 17074348
N-[[2-(2-methylpropoxy)phenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 17074348) has the molecular formula C16H18N2O2S2 and a molecular weight of 334.47 g/mol. Its IUPAC name is N-[[2-(2-methylpropoxy)phenyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[2-(2-methylpropoxy)phenyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17074348 |
| Molecular Formula | C16H18N2O2S2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-[[2-(2-methylpropoxy)phenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | CC(C)COc1ccccc1NC(=S)NC(=O)c1cccs1 |
| InChI | InChI=1S/C16H18N2O2S2/c1-11(2)10-20-13-7-4-3-6-12(13)17-16(21)18-15(19)14-8-5-9-22-14/h3-9,11H,10H2,1-2H3,(H2,17,18,19,21) |
| InChIKey | AIEZRMVLBHNDIT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|