C15H8Cl2N4O7S — CID 3290462
3,5-dichloro-2-[(3,5-dinitrobenzoyl)carbamothioylamino]benzoic acid (PubChem CID 3290462) has the molecular formula C15H8Cl2N4O7S and a molecular weight of 459.22 g/mol. Its IUPAC name is 3,5-dichloro-2-[(3,5-dinitrobenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 3,5-dichloro-2-[(3,5-dinitrobenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 3290462 |
| Molecular Formula | C15H8Cl2N4O7S |
| Molecular Weight | 459.22 g/mol |
| Exact Mass | 457.95 |
| IUPAC Name | 3,5-dichloro-2-[(3,5-dinitrobenzoyl)carbamothioylamino]benzoic acid |
| SMILES | O=C(NC(=S)Nc1c(Cl)cc(Cl)cc1C(=O)O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H8Cl2N4O7S/c16-7-3-10(14(23)24)12(11(17)4-7)18-15(29)19-13(22)6-1-8(20(25)26)5-9(2-6)21(27)28/h1-5H,(H,23,24)(H2,18,19,22,29) |
| InChIKey | FHAVBVVEIRFEMB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 164.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|