C15H19BrN2OS — CID 2375689
2-bromo-N-[[(1S,2R)-2-methylcyclohexyl]carbamothioyl]benzamide (PubChem CID 2375689) has the molecular formula C15H19BrN2OS and a molecular weight of 355.30 g/mol. Its IUPAC name is 2-bromo-N-[[(1S,2R)-2-methylcyclohexyl]carbamothioyl]benzamide.
| Compound Name | 2-bromo-N-[[(1S,2R)-2-methylcyclohexyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2375689 |
| Molecular Formula | C15H19BrN2OS |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 2-bromo-N-[[(1S,2R)-2-methylcyclohexyl]carbamothioyl]benzamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=S)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C15H19BrN2OS/c1-10-6-2-5-9-13(10)17-15(20)18-14(19)11-7-3-4-8-12(11)16/h3-4,7-8,10,13H,2,5-6,9H2,1H3,(H2,17,18,19,20)/t10-,13+/m1/s1 |
| InChIKey | NKLNOFMQXXTAHD-MFKMUULPSA-N |
| XLogP | 3.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|