C16H19BrN2O3 — CID 108973362
1-N'-(2-bromophenyl)-1-N-(oxolan-2-ylmethyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108973362) has the molecular formula C16H19BrN2O3 and a molecular weight of 367.24 g/mol. Its IUPAC name is 1-N'-(2-bromophenyl)-1-N-(oxolan-2-ylmethyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(2-bromophenyl)-1-N-(oxolan-2-ylmethyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108973362 |
| Molecular Formula | C16H19BrN2O3 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 1-N'-(2-bromophenyl)-1-N-(oxolan-2-ylmethyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(NCC1CCCO1)C1(C(=O)Nc2ccccc2Br)CC1 |
| InChI | InChI=1S/C16H19BrN2O3/c17-12-5-1-2-6-13(12)19-15(21)16(7-8-16)14(20)18-10-11-4-3-9-22-11/h1-2,5-6,11H,3-4,7-10H2,(H,18,20)(H,19,21) |
| InChIKey | OISZGRYXCCJQJG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|