C18H22N2O5 — CID 108973348
methyl 4-[[1-(oxolan-2-ylmethylcarbamoyl)cyclopropanecarbonyl]amino]benzoate (PubChem CID 108973348) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is methyl 4-[[1-(oxolan-2-ylmethylcarbamoyl)cyclopropanecarbonyl]amino]benzoate.
| Compound Name | methyl 4-[[1-(oxolan-2-ylmethylcarbamoyl)cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 108973348 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | methyl 4-[[1-(oxolan-2-ylmethylcarbamoyl)cyclopropanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2(C(=O)NCC3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C18H22N2O5/c1-24-15(21)12-4-6-13(7-5-12)20-17(23)18(8-9-18)16(22)19-11-14-3-2-10-25-14/h4-7,14H,2-3,8-11H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | ZFLQNHNLDQQVGP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|