C18H24N2O5 — CID 108960123
methyl 4-[[2,2-dimethyl-3-oxo-3-(oxolan-2-ylmethylamino)propanoyl]amino]benzoate (PubChem CID 108960123) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl 4-[[2,2-dimethyl-3-oxo-3-(oxolan-2-ylmethylamino)propanoyl]amino]benzoate.
| Compound Name | methyl 4-[[2,2-dimethyl-3-oxo-3-(oxolan-2-ylmethylamino)propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108960123 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | methyl 4-[[2,2-dimethyl-3-oxo-3-(oxolan-2-ylmethylamino)propanoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C(C)(C)C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C18H24N2O5/c1-18(2,16(22)19-11-14-5-4-10-25-14)17(23)20-13-8-6-12(7-9-13)15(21)24-3/h6-9,14H,4-5,10-11H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | STCYPVDFIIZAQE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|