C18H25ClN2O5 — CID 108960159
N-(4-chloro-2,5-dimethoxyphenyl)-2,2-dimethyl-N'-(oxolan-2-ylmethyl)propanediamide (PubChem CID 108960159) has the molecular formula C18H25ClN2O5 and a molecular weight of 384.86 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2,2-dimethyl-N'-(oxolan-2-ylmethyl)propanediamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2,2-dimethyl-N'-(oxolan-2-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 108960159 |
| Molecular Formula | C18H25ClN2O5 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2,2-dimethyl-N'-(oxolan-2-ylmethyl)propanediamide |
| SMILES | COc1cc(NC(=O)C(C)(C)C(=O)NCC2CCCO2)c(OC)cc1Cl |
| InChI | InChI=1S/C18H25ClN2O5/c1-18(2,16(22)20-10-11-6-5-7-26-11)17(23)21-13-9-14(24-3)12(19)8-15(13)25-4/h8-9,11H,5-7,10H2,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | AAAKUHWBAVGPJY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|