C12H10N2 — CID 174264832
2,3-dimethylquinoline-8-carbonitrile (PubChem CID 174264832) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is 2,3-dimethylquinoline-8-carbonitrile.
| Compound Name | 2,3-dimethylquinoline-8-carbonitrile |
|---|---|
| PubChem CID | 174264832 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 2,3-dimethylquinoline-8-carbonitrile |
| SMILES | Cc1cc2cccc(C#N)c2nc1C |
| InChI | InChI=1S/C12H10N2/c1-8-6-10-4-3-5-11(7-13)12(10)14-9(8)2/h3-6H,1-2H3 |
| InChIKey | WZVGMSBHHURGFW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |