C10H4N4 — CID 172609726
cinnoline-3,8-dicarbonitrile (PubChem CID 172609726) has the molecular formula C10H4N4 and a molecular weight of 180.17 g/mol. Its IUPAC name is cinnoline-3,8-dicarbonitrile.
| Compound Name | cinnoline-3,8-dicarbonitrile |
|---|---|
| PubChem CID | 172609726 |
| Molecular Formula | C10H4N4 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | cinnoline-3,8-dicarbonitrile |
| SMILES | N#Cc1cc2cccc(C#N)c2nn1 |
| InChI | InChI=1S/C10H4N4/c11-5-8-3-1-2-7-4-9(6-12)13-14-10(7)8/h1-4H |
| InChIKey | BNKZQTBDRVHVOB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |