C8H7ClN2 — CID 12891106
2-chloro-5,6-dimethylpyridine-3-carbonitrile (PubChem CID 12891106) has the molecular formula C8H7ClN2 and a molecular weight of 166.61 g/mol. Its IUPAC name is 2-chloro-5,6-dimethylpyridine-3-carbonitrile.
| Compound Name | 2-chloro-5,6-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 12891106 |
| Molecular Formula | C8H7ClN2 |
| Molecular Weight | 166.61 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 2-chloro-5,6-dimethylpyridine-3-carbonitrile |
| SMILES | Cc1cc(C#N)c(Cl)nc1C |
| InChI | InChI=1S/C8H7ClN2/c1-5-3-7(4-10)8(9)11-6(5)2/h3H,1-2H3 |
| InChIKey | BYVPJDZJIHOUHA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.61 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|