C16H13N3 — CID 104720542
2-(2,5-dimethylphenyl)-1H-benzimidazole-4-carbonitrile (PubChem CID 104720542) has the molecular formula C16H13N3 and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-1H-benzimidazole-4-carbonitrile.
| Compound Name | 2-(2,5-dimethylphenyl)-1H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104720542 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1H-benzimidazole-4-carbonitrile |
| SMILES | Cc1ccc(C)c(-c2nc3c(C#N)cccc3[nH]2)c1 |
| InChI | InChI=1S/C16H13N3/c1-10-6-7-11(2)13(8-10)16-18-14-5-3-4-12(9-17)15(14)19-16/h3-8H,1-2H3,(H,18,19) |
| InChIKey | QJIJWFFKBBGCEA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |