C14H7Cl2N3 — CID 104720410
2-(2,5-dichlorophenyl)-1H-benzimidazole-4-carbonitrile (PubChem CID 104720410) has the molecular formula C14H7Cl2N3 and a molecular weight of 288.14 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-1H-benzimidazole-4-carbonitrile.
| Compound Name | 2-(2,5-dichlorophenyl)-1H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104720410 |
| Molecular Formula | C14H7Cl2N3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-1H-benzimidazole-4-carbonitrile |
| SMILES | N#Cc1cccc2[nH]c(-c3cc(Cl)ccc3Cl)nc12 |
| InChI | InChI=1S/C14H7Cl2N3/c15-9-4-5-11(16)10(6-9)14-18-12-3-1-2-8(7-17)13(12)19-14/h1-6H,(H,18,19) |
| InChIKey | MXNJVIGVKDDHBR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |