C23H32N6OS — CID 3221635
1-[3-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]propyl]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 3221635) has the molecular formula C23H32N6OS and a molecular weight of 440.62 g/mol. Its IUPAC name is 1-[3-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]propyl]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[3-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]propyl]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 3221635 |
| Molecular Formula | C23H32N6OS |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 1-[3-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]propyl]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1cc(C)c2cc(C#N)c(NCCCNC(=S)NCCCN3CCOCC3)nc2c1 |
| InChI | InChI=1S/C23H32N6OS/c1-17-13-18(2)20-15-19(16-24)22(28-21(20)14-17)25-5-3-6-26-23(31)27-7-4-8-29-9-11-30-12-10-29/h13-15H,3-12H2,1-2H3,(H,25,28)(H2,26,27,31) |
| InChIKey | QTDFRLFUFZHRLA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|