C17H19N5O2S — CID 91736295
1-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propyl]-3-ethylthiourea (PubChem CID 91736295) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is 1-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propyl]-3-ethylthiourea.
| Compound Name | 1-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propyl]-3-ethylthiourea |
|---|---|
| PubChem CID | 91736295 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propyl]-3-ethylthiourea |
| SMILES | CCNC(=S)NCCCNc1nc2cc3c(cc2cc1C#N)OCO3 |
| InChI | InChI=1S/C17H19N5O2S/c1-2-19-17(25)21-5-3-4-20-16-12(9-18)6-11-7-14-15(24-10-23-14)8-13(11)22-16/h6-8H,2-5,10H2,1H3,(H,20,22)(H2,19,21,25) |
| InChIKey | KQUBAOZBBXZFOT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|