C22H21N5O4 — CID 43815024
1-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propyl]-3-(2-methoxyphenyl)urea (PubChem CID 43815024) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is 1-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 43815024 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 1-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NCCCNc1nc2cc3c(cc2cc1C#N)OCO3 |
| InChI | InChI=1S/C22H21N5O4/c1-29-18-6-3-2-5-16(18)27-22(28)25-8-4-7-24-21-15(12-23)9-14-10-19-20(31-13-30-19)11-17(14)26-21/h2-3,5-6,9-11H,4,7-8,13H2,1H3,(H,24,26)(H2,25,27,28) |
| InChIKey | YQEOAYQCJVMSMH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|