C22H20N4O5 — CID 43815489
N-[2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]ethyl]-3,4-dimethoxybenzamide (PubChem CID 43815489) has the molecular formula C22H20N4O5 and a molecular weight of 420.43 g/mol. Its IUPAC name is N-[2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 43815489 |
| Molecular Formula | C22H20N4O5 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]ethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCNc2nc3cc4c(cc3cc2C#N)OCO4)cc1OC |
| InChI | InChI=1S/C22H20N4O5/c1-28-17-4-3-13(8-18(17)29-2)22(27)25-6-5-24-21-15(11-23)7-14-9-19-20(31-12-30-19)10-16(14)26-21/h3-4,7-10H,5-6,12H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | GVVXWCSKWVELAK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|