C20H23N5O3 — CID 43815111
1-[2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]ethyl]-3-cyclohexylurea (PubChem CID 43815111) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 1-[2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]ethyl]-3-cyclohexylurea.
| Compound Name | 1-[2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]ethyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 43815111 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 1-[2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]ethyl]-3-cyclohexylurea |
| SMILES | N#Cc1cc2cc3c(cc2nc1NCCNC(=O)NC1CCCCC1)OCO3 |
| InChI | InChI=1S/C20H23N5O3/c21-11-14-8-13-9-17-18(28-12-27-17)10-16(13)25-19(14)22-6-7-23-20(26)24-15-4-2-1-3-5-15/h8-10,15H,1-7,12H2,(H,22,25)(H2,23,24,26) |
| InChIKey | YRLCKIOUZZITJK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|