C22H21N5O3 — CID 43815114
1-benzyl-3-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propyl]urea (PubChem CID 43815114) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 1-benzyl-3-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propyl]urea.
| Compound Name | 1-benzyl-3-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propyl]urea |
|---|---|
| PubChem CID | 43815114 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-benzyl-3-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propyl]urea |
| SMILES | N#Cc1cc2cc3c(cc2nc1NCCCNC(=O)NCc1ccccc1)OCO3 |
| InChI | InChI=1S/C22H21N5O3/c23-12-17-9-16-10-19-20(30-14-29-19)11-18(16)27-21(17)24-7-4-8-25-22(28)26-13-15-5-2-1-3-6-15/h1-3,5-6,9-11H,4,7-8,13-14H2,(H,24,27)(H2,25,26,28) |
| InChIKey | NJRVTUZAASGSCC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|