C25H18N4O3 — CID 10224036
N-[4-(benzylamino)-3-cyanoquinolin-2-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 10224036) has the molecular formula C25H18N4O3 and a molecular weight of 422.44 g/mol. Its IUPAC name is N-[4-(benzylamino)-3-cyanoquinolin-2-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-(benzylamino)-3-cyanoquinolin-2-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 10224036 |
| Molecular Formula | C25H18N4O3 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[4-(benzylamino)-3-cyanoquinolin-2-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | N#Cc1c(NC(=O)c2ccc3c(c2)OCO3)nc2ccccc2c1NCc1ccccc1 |
| InChI | InChI=1S/C25H18N4O3/c26-13-19-23(27-14-16-6-2-1-3-7-16)18-8-4-5-9-20(18)28-24(19)29-25(30)17-10-11-21-22(12-17)32-15-31-21/h1-12H,14-15H2,(H2,27,28,29,30) |
| InChIKey | ASXCZWNWTKMPIU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |