C13H10N4O3 — CID 104593117
N-(4-cyano-1-methylpyrazol-3-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 104593117) has the molecular formula C13H10N4O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is N-(4-cyano-1-methylpyrazol-3-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(4-cyano-1-methylpyrazol-3-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 104593117 |
| Molecular Formula | C13H10N4O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-(4-cyano-1-methylpyrazol-3-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | Cn1cc(C#N)c(NC(=O)c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C13H10N4O3/c1-17-6-9(5-14)12(16-17)15-13(18)8-2-3-10-11(4-8)20-7-19-10/h2-4,6H,7H2,1H3,(H,15,16,18) |
| InChIKey | WOMJVHRDBHJXEQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |