C10H9N5O3 — CID 959481
N-(2-methyltetrazol-5-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 959481) has the molecular formula C10H9N5O3 and a molecular weight of 247.21 g/mol. Its IUPAC name is N-(2-methyltetrazol-5-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(2-methyltetrazol-5-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 959481 |
| Molecular Formula | C10H9N5O3 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N-(2-methyltetrazol-5-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | Cn1nnc(NC(=O)c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C10H9N5O3/c1-15-13-10(12-14-15)11-9(16)6-2-3-7-8(4-6)18-5-17-7/h2-4H,5H2,1H3,(H,11,13,16) |
| InChIKey | LEHZURYTIHESDT-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |